C19H26N2O3 — CID 91377340
5-(1,3-benzodioxol-5-yl)-4-methyl-N-(2-pyrrolidin-1-ylethyl)pent-2-enamide (PubChem CID 91377340) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-4-methyl-N-(2-pyrrolidin-1-ylethyl)pent-2-enamide.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-4-methyl-N-(2-pyrrolidin-1-ylethyl)pent-2-enamide |
|---|---|
| PubChem CID | 91377340 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-4-methyl-N-(2-pyrrolidin-1-ylethyl)pent-2-enamide |
| SMILES | CC(C=CC(=O)NCCN1CCCC1)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H26N2O3/c1-15(12-16-5-6-17-18(13-16)24-14-23-17)4-7-19(22)20-8-11-21-9-2-3-10-21/h4-7,13,15H,2-3,8-12,14H2,1H3,(H,20,22) |
| InChIKey | ZCWSRUPKLHQTCV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|