C21H33N3O3 — CID 168989295
N-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylamino]methyl]-3-piperidin-1-ylpropanamide (PubChem CID 168989295) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is N-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylamino]methyl]-3-piperidin-1-ylpropanamide.
| Compound Name | N-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylamino]methyl]-3-piperidin-1-ylpropanamide |
|---|---|
| PubChem CID | 168989295 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | N-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylamino]methyl]-3-piperidin-1-ylpropanamide |
| SMILES | CCN(CNC(=O)CCN1CCCCC1)C(C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H33N3O3/c1-3-24(15-22-21(25)9-12-23-10-5-4-6-11-23)17(2)13-18-7-8-19-20(14-18)27-16-26-19/h7-8,14,17H,3-6,9-13,15-16H2,1-2H3,(H,22,25) |
| InChIKey | MIZYVOPEOOGQBB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|