C20H30N4O4 — CID 168989879
N-[[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylamino]methyl]-3-(4-methylpiperazin-1-yl)propanamide (PubChem CID 168989879) has the molecular formula C20H30N4O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is N-[[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylamino]methyl]-3-(4-methylpiperazin-1-yl)propanamide.
| Compound Name | N-[[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylamino]methyl]-3-(4-methylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 168989879 |
| Molecular Formula | C20H30N4O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | N-[[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylamino]methyl]-3-(4-methylpiperazin-1-yl)propanamide |
| SMILES | CC(C(=O)c1ccc2c(c1)OCO2)N(C)CNC(=O)CCN1CCN(C)CC1 |
| InChI | InChI=1S/C20H30N4O4/c1-15(20(26)16-4-5-17-18(12-16)28-14-27-17)23(3)13-21-19(25)6-7-24-10-8-22(2)9-11-24/h4-5,12,15H,6-11,13-14H2,1-3H3,(H,21,25) |
| InChIKey | AKOWHLAVACCSQQ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|