C21H29N3O7 — CID 168989771
1-[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylcarbamoyl]oxyethyl 2-(4-methylpiperazin-1-yl)acetate (PubChem CID 168989771) has the molecular formula C21H29N3O7 and a molecular weight of 435.48 g/mol. Its IUPAC name is 1-[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylcarbamoyl]oxyethyl 2-(4-methylpiperazin-1-yl)acetate.
| Compound Name | 1-[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylcarbamoyl]oxyethyl 2-(4-methylpiperazin-1-yl)acetate |
|---|---|
| PubChem CID | 168989771 |
| Molecular Formula | C21H29N3O7 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 1-[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylcarbamoyl]oxyethyl 2-(4-methylpiperazin-1-yl)acetate |
| SMILES | CC(OC(=O)CN1CCN(C)CC1)OC(=O)N(C)C(C)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H29N3O7/c1-14(20(26)16-5-6-17-18(11-16)29-13-28-17)23(4)21(27)31-15(2)30-19(25)12-24-9-7-22(3)8-10-24/h5-6,11,14-15H,7-10,12-13H2,1-4H3 |
| InChIKey | LFYDMMNUVGATDL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 97.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|