C17H21NO8 — CID 168990047
[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylcarbamoyl]oxymethyl 3-methoxypropanoate (PubChem CID 168990047) has the molecular formula C17H21NO8 and a molecular weight of 367.35 g/mol. Its IUPAC name is [[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylcarbamoyl]oxymethyl 3-methoxypropanoate.
| Compound Name | [[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylcarbamoyl]oxymethyl 3-methoxypropanoate |
|---|---|
| PubChem CID | 168990047 |
| Molecular Formula | C17H21NO8 |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | [[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylcarbamoyl]oxymethyl 3-methoxypropanoate |
| SMILES | COCCC(=O)OCOC(=O)N(C)C(C)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H21NO8/c1-11(16(20)12-4-5-13-14(8-12)24-9-23-13)18(2)17(21)26-10-25-15(19)6-7-22-3/h4-5,8,11H,6-7,9-10H2,1-3H3 |
| InChIKey | PCDQTTCQLAWHBX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|