C17H21NO6 — CID 168990157
2-cyclopropyloxyethyl N-[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-N-methylcarbamate (PubChem CID 168990157) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-cyclopropyloxyethyl N-[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-N-methylcarbamate.
| Compound Name | 2-cyclopropyloxyethyl N-[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 168990157 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-cyclopropyloxyethyl N-[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-N-methylcarbamate |
| SMILES | CC(C(=O)c1ccc2c(c1)OCO2)N(C)C(=O)OCCOC1CC1 |
| InChI | InChI=1S/C17H21NO6/c1-11(18(2)17(20)22-8-7-21-13-4-5-13)16(19)12-3-6-14-15(9-12)24-10-23-14/h3,6,9,11,13H,4-5,7-8,10H2,1-2H3 |
| InChIKey | RGMMCIXVKDYHFB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|