C19H23NO9 — CID 168989777
[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylcarbamoyl]oxymethyl oxan-4-yl carbonate (PubChem CID 168989777) has the molecular formula C19H23NO9 and a molecular weight of 409.39 g/mol. Its IUPAC name is [[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylcarbamoyl]oxymethyl oxan-4-yl carbonate.
| Compound Name | [[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylcarbamoyl]oxymethyl oxan-4-yl carbonate |
|---|---|
| PubChem CID | 168989777 |
| Molecular Formula | C19H23NO9 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | [[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylcarbamoyl]oxymethyl oxan-4-yl carbonate |
| SMILES | CC(C(=O)c1ccc2c(c1)OCO2)N(C)C(=O)OCOC(=O)OC1CCOCC1 |
| InChI | InChI=1S/C19H23NO9/c1-12(17(21)13-3-4-15-16(9-13)26-10-25-15)20(2)18(22)27-11-28-19(23)29-14-5-7-24-8-6-14/h3-4,9,12,14H,5-8,10-11H2,1-2H3 |
| InChIKey | JLYZFWBQQCHSRB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|