C19H25NO8 — CID 166468666
[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylcarbamoyl]oxymethyl oxan-4-yl carbonate (PubChem CID 166468666) has the molecular formula C19H25NO8 and a molecular weight of 395.41 g/mol. Its IUPAC name is [1-(1,3-benzodioxol-5-yl)propan-2-yl-methylcarbamoyl]oxymethyl oxan-4-yl carbonate.
| Compound Name | [1-(1,3-benzodioxol-5-yl)propan-2-yl-methylcarbamoyl]oxymethyl oxan-4-yl carbonate |
|---|---|
| PubChem CID | 166468666 |
| Molecular Formula | C19H25NO8 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | [1-(1,3-benzodioxol-5-yl)propan-2-yl-methylcarbamoyl]oxymethyl oxan-4-yl carbonate |
| SMILES | CC(Cc1ccc2c(c1)OCO2)N(C)C(=O)OCOC(=O)OC1CCOCC1 |
| InChI | InChI=1S/C19H25NO8/c1-13(9-14-3-4-16-17(10-14)25-11-24-16)20(2)18(21)26-12-27-19(22)28-15-5-7-23-8-6-15/h3-4,10,13,15H,5-9,11-12H2,1-2H3 |
| InChIKey | QECCAFCMQLUENL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|