C20H28N2O7 — CID 168989339
[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylcarbamoyl]oxymethyl piperidin-4-yl carbonate (PubChem CID 168989339) has the molecular formula C20H28N2O7 and a molecular weight of 408.45 g/mol. Its IUPAC name is [1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylcarbamoyl]oxymethyl piperidin-4-yl carbonate.
| Compound Name | [1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylcarbamoyl]oxymethyl piperidin-4-yl carbonate |
|---|---|
| PubChem CID | 168989339 |
| Molecular Formula | C20H28N2O7 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | [1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylcarbamoyl]oxymethyl piperidin-4-yl carbonate |
| SMILES | CCN(C(=O)OCOC(=O)OC1CCNCC1)C(C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H28N2O7/c1-3-22(14(2)10-15-4-5-17-18(11-15)26-12-25-17)19(23)27-13-28-20(24)29-16-6-8-21-9-7-16/h4-5,11,14,16,21H,3,6-10,12-13H2,1-2H3 |
| InChIKey | HURRPZDOIHTFIO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 95.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|