C18H23NO9S — CID 168989444
[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylcarbamoyl]oxymethyl (1,1-dioxothietan-3-yl) carbonate (PubChem CID 168989444) has the molecular formula C18H23NO9S and a molecular weight of 429.45 g/mol. Its IUPAC name is [1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylcarbamoyl]oxymethyl (1,1-dioxothietan-3-yl) carbonate.
| Compound Name | [1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylcarbamoyl]oxymethyl (1,1-dioxothietan-3-yl) carbonate |
|---|---|
| PubChem CID | 168989444 |
| Molecular Formula | C18H23NO9S |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | [1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylcarbamoyl]oxymethyl (1,1-dioxothietan-3-yl) carbonate |
| SMILES | CCN(C(=O)OCOC(=O)OC1CS(=O)(=O)C1)C(C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H23NO9S/c1-3-19(12(2)6-13-4-5-15-16(7-13)25-10-24-15)17(20)26-11-27-18(21)28-14-8-29(22,23)9-14/h4-5,7,12,14H,3,6,8-11H2,1-2H3 |
| InChIKey | IMPLDLNGJIINCM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|