C17H24N2O6 — CID 166468611
[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylcarbamoyl]oxymethyl 2-(dimethylamino)acetate (PubChem CID 166468611) has the molecular formula C17H24N2O6 and a molecular weight of 352.39 g/mol. Its IUPAC name is [1-(1,3-benzodioxol-5-yl)propan-2-yl-methylcarbamoyl]oxymethyl 2-(dimethylamino)acetate.
| Compound Name | [1-(1,3-benzodioxol-5-yl)propan-2-yl-methylcarbamoyl]oxymethyl 2-(dimethylamino)acetate |
|---|---|
| PubChem CID | 166468611 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | [1-(1,3-benzodioxol-5-yl)propan-2-yl-methylcarbamoyl]oxymethyl 2-(dimethylamino)acetate |
| SMILES | CC(Cc1ccc2c(c1)OCO2)N(C)C(=O)OCOC(=O)CN(C)C |
| InChI | InChI=1S/C17H24N2O6/c1-12(7-13-5-6-14-15(8-13)23-10-22-14)19(4)17(21)25-11-24-16(20)9-18(2)3/h5-6,8,12H,7,9-11H2,1-4H3 |
| InChIKey | XTQDBJKJDBDDMQ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|