C17H24N2O7 — CID 166468376
1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylcarbamoyl]oxyethyl 2-amino-3-hydroxypropanoate (PubChem CID 166468376) has the molecular formula C17H24N2O7 and a molecular weight of 368.39 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylcarbamoyl]oxyethyl 2-amino-3-hydroxypropanoate.
| Compound Name | 1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylcarbamoyl]oxyethyl 2-amino-3-hydroxypropanoate |
|---|---|
| PubChem CID | 166468376 |
| Molecular Formula | C17H24N2O7 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylcarbamoyl]oxyethyl 2-amino-3-hydroxypropanoate |
| SMILES | CC(OC(=O)C(N)CO)OC(=O)N(C)C(C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H24N2O7/c1-10(6-12-4-5-14-15(7-12)24-9-23-14)19(3)17(22)26-11(2)25-16(21)13(18)8-20/h4-5,7,10-11,13,20H,6,8-9,18H2,1-3H3 |
| InChIKey | GVKXVSDLKRLBFC-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 120.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|