C18H25NO9S — CID 166468318
1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylcarbamoyl]oxyethyl 2-methylsulfonylethyl carbonate (PubChem CID 166468318) has the molecular formula C18H25NO9S and a molecular weight of 431.46 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylcarbamoyl]oxyethyl 2-methylsulfonylethyl carbonate.
| Compound Name | 1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylcarbamoyl]oxyethyl 2-methylsulfonylethyl carbonate |
|---|---|
| PubChem CID | 166468318 |
| Molecular Formula | C18H25NO9S |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylcarbamoyl]oxyethyl 2-methylsulfonylethyl carbonate |
| SMILES | CC(OC(=O)OCCS(C)(=O)=O)OC(=O)N(C)C(C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H25NO9S/c1-12(9-14-5-6-15-16(10-14)26-11-25-15)19(3)17(20)27-13(2)28-18(21)24-7-8-29(4,22)23/h5-6,10,12-13H,7-9,11H2,1-4H3 |
| InChIKey | LDFPDSUIAMKEEO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|