C18H23NO8S — CID 168989915
1-[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylcarbamoyl]oxyethyl 2-methylsulfanylethyl carbonate (PubChem CID 168989915) has the molecular formula C18H23NO8S and a molecular weight of 413.45 g/mol. Its IUPAC name is 1-[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylcarbamoyl]oxyethyl 2-methylsulfanylethyl carbonate.
| Compound Name | 1-[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylcarbamoyl]oxyethyl 2-methylsulfanylethyl carbonate |
|---|---|
| PubChem CID | 168989915 |
| Molecular Formula | C18H23NO8S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 1-[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylcarbamoyl]oxyethyl 2-methylsulfanylethyl carbonate |
| SMILES | CSCCOC(=O)OC(C)OC(=O)N(C)C(C)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H23NO8S/c1-11(16(20)13-5-6-14-15(9-13)25-10-24-14)19(3)17(21)26-12(2)27-18(22)23-7-8-28-4/h5-6,9,11-12H,7-8,10H2,1-4H3 |
| InChIKey | ZFTKADVEFCBJEO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|