C20H27NO8 — CID 168989348
6-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylcarbamoyl]oxymethoxy]-6-oxohexanoic acid (PubChem CID 168989348) has the molecular formula C20H27NO8 and a molecular weight of 409.44 g/mol. Its IUPAC name is 6-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylcarbamoyl]oxymethoxy]-6-oxohexanoic acid.
| Compound Name | 6-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylcarbamoyl]oxymethoxy]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 168989348 |
| Molecular Formula | C20H27NO8 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 6-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylcarbamoyl]oxymethoxy]-6-oxohexanoic acid |
| SMILES | CCN(C(=O)OCOC(=O)CCCCC(=O)O)C(C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H27NO8/c1-3-21(14(2)10-15-8-9-16-17(11-15)27-12-26-16)20(25)29-13-28-19(24)7-5-4-6-18(22)23/h8-9,11,14H,3-7,10,12-13H2,1-2H3,(H,22,23) |
| InChIKey | ZWYRHWDUBXRAHJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|