C17H25NO9Y — CID 168989614
hydroxy N-[1-(1,3-benzodioxol-5-yl)propan-2-yl]-N-ethylcarbamoperoxoate;4-hydroxybutanoic acid;yttrium (PubChem CID 168989614) has the molecular formula C17H25NO9Y and a molecular weight of 476.29 g/mol. Its IUPAC name is hydroxy N-[1-(1,3-benzodioxol-5-yl)propan-2-yl]-N-ethylcarbamoperoxoate;4-hydroxybutanoic acid;yttrium.
| Compound Name | hydroxy N-[1-(1,3-benzodioxol-5-yl)propan-2-yl]-N-ethylcarbamoperoxoate;4-hydroxybutanoic acid;yttrium |
|---|---|
| PubChem CID | 168989614 |
| Molecular Formula | C17H25NO9Y |
| Molecular Weight | 476.29 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | hydroxy N-[1-(1,3-benzodioxol-5-yl)propan-2-yl]-N-ethylcarbamoperoxoate;4-hydroxybutanoic acid;yttrium |
| SMILES | CCN(C(=O)OOO)C(C)Cc1ccc2c(c1)OCO2.O=C(O)CCCO.[Y] |
| InChI | InChI=1S/C13H17NO6.C4H8O3.Y/c1-3-14(13(15)19-20-16)9(2)6-10-4-5-11-12(7-10)18-8-17-11;5-3-1-2-4(6)7;/h4-5,7,9,16H,3,6,8H2,1-2H3;5H,1-3H2,(H,6,7); |
| InChIKey | GNLCFWGGBHCKPV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 134.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|