C18H24N2O6 — CID 168990144
N-[[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylamino]methyl]-3-(oxetan-3-yloxy)propanamide (PubChem CID 168990144) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is N-[[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylamino]methyl]-3-(oxetan-3-yloxy)propanamide.
| Compound Name | N-[[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylamino]methyl]-3-(oxetan-3-yloxy)propanamide |
|---|---|
| PubChem CID | 168990144 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-[[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylamino]methyl]-3-(oxetan-3-yloxy)propanamide |
| SMILES | CC(C(=O)c1ccc2c(c1)OCO2)N(C)CNC(=O)CCOC1COC1 |
| InChI | InChI=1S/C18H24N2O6/c1-12(18(22)13-3-4-15-16(7-13)26-11-25-15)20(2)10-19-17(21)5-6-24-14-8-23-9-14/h3-4,7,12,14H,5-6,8-11H2,1-2H3,(H,19,21) |
| InChIKey | BTWJYIDNEFVJTR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|