C12H12B3NO3 — CID 174080937
CID 174080937 (PubChem CID 174080937) has the molecular formula C12H12B3NO3 and a molecular weight of 250.67 g/mol.
| Compound Name | CID 174080937 |
|---|---|
| PubChem CID | 174080937 |
| Molecular Formula | C12H12B3NO3 |
| Molecular Weight | 250.67 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])N(C)C(C)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H12B3NO3/c1-7(16(2)12(13,14)15)11(17)8-3-4-9-10(5-8)19-6-18-9/h3-5,7H,6H2,1-2H3 |
| InChIKey | HROKVYCODCBPHO-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.67 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|