C11H11B2NO3 — CID 174080879
CID 174080879 (PubChem CID 174080879) has the molecular formula C11H11B2NO3 and a molecular weight of 226.84 g/mol.
| Compound Name | CID 174080879 |
|---|---|
| PubChem CID | 174080879 |
| Molecular Formula | C11H11B2NO3 |
| Molecular Weight | 226.84 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | — |
| SMILES | [B]C([B])NC(C)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H11B2NO3/c1-6(14-11(12)13)10(15)7-2-3-8-9(4-7)17-5-16-8/h2-4,6,11,14H,5H2,1H3 |
| InChIKey | KTBVNTPLHJAVRE-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.84 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|