C18H27N3O4 — CID 168990094
2-amino-N-[1-[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]amino]ethyl]-3-methylpentanamide (PubChem CID 168990094) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-amino-N-[1-[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]amino]ethyl]-3-methylpentanamide.
| Compound Name | 2-amino-N-[1-[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]amino]ethyl]-3-methylpentanamide |
|---|---|
| PubChem CID | 168990094 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 2-amino-N-[1-[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]amino]ethyl]-3-methylpentanamide |
| SMILES | CCC(C)C(N)C(=O)NC(C)NC(C)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H27N3O4/c1-5-10(2)16(19)18(23)21-12(4)20-11(3)17(22)13-6-7-14-15(8-13)25-9-24-14/h6-8,10-12,16,20H,5,9,19H2,1-4H3,(H,21,23) |
| InChIKey | MIFUDUYQLQPGIV-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|