C20H33N3O3 — CID 168989420
2-amino-N-[1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylamino]ethyl]-3-methylpentanamide (PubChem CID 168989420) has the molecular formula C20H33N3O3 and a molecular weight of 363.50 g/mol. Its IUPAC name is 2-amino-N-[1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylamino]ethyl]-3-methylpentanamide.
| Compound Name | 2-amino-N-[1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylamino]ethyl]-3-methylpentanamide |
|---|---|
| PubChem CID | 168989420 |
| Molecular Formula | C20H33N3O3 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | 2-amino-N-[1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylamino]ethyl]-3-methylpentanamide |
| SMILES | CCC(C)C(N)C(=O)NC(C)N(CC)C(C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H33N3O3/c1-6-13(3)19(21)20(24)22-15(5)23(7-2)14(4)10-16-8-9-17-18(11-16)26-12-25-17/h8-9,11,13-15,19H,6-7,10,12,21H2,1-5H3,(H,22,24) |
| InChIKey | NWSJVGFWEQALMJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|