C18H28N2O3S — CID 168989608
N-[1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylamino]ethyl]-3-methylsulfanylpropanamide (PubChem CID 168989608) has the molecular formula C18H28N2O3S and a molecular weight of 352.50 g/mol. Its IUPAC name is N-[1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylamino]ethyl]-3-methylsulfanylpropanamide.
| Compound Name | N-[1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylamino]ethyl]-3-methylsulfanylpropanamide |
|---|---|
| PubChem CID | 168989608 |
| Molecular Formula | C18H28N2O3S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-[1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylamino]ethyl]-3-methylsulfanylpropanamide |
| SMILES | CCN(C(C)Cc1ccc2c(c1)OCO2)C(C)NC(=O)CCSC |
| InChI | InChI=1S/C18H28N2O3S/c1-5-20(14(3)19-18(21)8-9-24-4)13(2)10-15-6-7-16-17(11-15)23-12-22-16/h6-7,11,13-14H,5,8-10,12H2,1-4H3,(H,19,21) |
| InChIKey | VVVKKVHQIRRJJP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|