C17H26N2O4 — CID 168989294
N-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylamino]methyl]-3-methoxypropanamide (PubChem CID 168989294) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylamino]methyl]-3-methoxypropanamide.
| Compound Name | N-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylamino]methyl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 168989294 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | N-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylamino]methyl]-3-methoxypropanamide |
| SMILES | CCN(CNC(=O)CCOC)C(C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H26N2O4/c1-4-19(11-18-17(20)7-8-21-3)13(2)9-14-5-6-15-16(10-14)23-12-22-15/h5-6,10,13H,4,7-9,11-12H2,1-3H3,(H,18,20) |
| InChIKey | OEGHCERJVZFROA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|