C18H27N3O3 — CID 166468269
N-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylamino]methyl]-2-pyrrolidin-1-ylacetamide (PubChem CID 166468269) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is N-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylamino]methyl]-2-pyrrolidin-1-ylacetamide.
| Compound Name | N-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylamino]methyl]-2-pyrrolidin-1-ylacetamide |
|---|---|
| PubChem CID | 166468269 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | N-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylamino]methyl]-2-pyrrolidin-1-ylacetamide |
| SMILES | CC(Cc1ccc2c(c1)OCO2)N(C)CNC(=O)CN1CCCC1 |
| InChI | InChI=1S/C18H27N3O3/c1-14(9-15-5-6-16-17(10-15)24-13-23-16)20(2)12-19-18(22)11-21-7-3-4-8-21/h5-6,10,14H,3-4,7-9,11-13H2,1-2H3,(H,19,22) |
| InChIKey | SPEILGIAOBYITK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|