C20H32N4O3 — CID 166468594
N-[1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylamino]ethyl]-2-(4-methylpiperazin-1-yl)acetamide (PubChem CID 166468594) has the molecular formula C20H32N4O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is N-[1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylamino]ethyl]-2-(4-methylpiperazin-1-yl)acetamide.
| Compound Name | N-[1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylamino]ethyl]-2-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 166468594 |
| Molecular Formula | C20H32N4O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | N-[1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylamino]ethyl]-2-(4-methylpiperazin-1-yl)acetamide |
| SMILES | CC(Cc1ccc2c(c1)OCO2)N(C)C(C)NC(=O)CN1CCN(C)CC1 |
| InChI | InChI=1S/C20H32N4O3/c1-15(11-17-5-6-18-19(12-17)27-14-26-18)23(4)16(2)21-20(25)13-24-9-7-22(3)8-10-24/h5-6,12,15-16H,7-11,13-14H2,1-4H3,(H,21,25) |
| InChIKey | PVFYVKLVYZONQW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|