C22H31N3O3 — CID 166468415
N-[1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylamino]ethyl]-1-propan-2-yl-4H-pyridine-3-carboxamide (PubChem CID 166468415) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-[1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylamino]ethyl]-1-propan-2-yl-4H-pyridine-3-carboxamide.
| Compound Name | N-[1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylamino]ethyl]-1-propan-2-yl-4H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 166468415 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | N-[1-[1-(1,3-benzodioxol-5-yl)propan-2-yl-methylamino]ethyl]-1-propan-2-yl-4H-pyridine-3-carboxamide |
| SMILES | CC(C)N1C=CCC(C(=O)NC(C)N(C)C(C)Cc2ccc3c(c2)OCO3)=C1 |
| InChI | InChI=1S/C22H31N3O3/c1-15(2)25-10-6-7-19(13-25)22(26)23-17(4)24(5)16(3)11-18-8-9-20-21(12-18)28-14-27-20/h6,8-10,12-13,15-17H,7,11,14H2,1-5H3,(H,23,26) |
| InChIKey | UPLABQBXUNTXIS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|