C26H31N3O3 — CID 168989545
N-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylamino]methyl]-1-benzyl-4H-pyridine-3-carboxamide (PubChem CID 168989545) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is N-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylamino]methyl]-1-benzyl-4H-pyridine-3-carboxamide.
| Compound Name | N-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylamino]methyl]-1-benzyl-4H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 168989545 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | N-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylamino]methyl]-1-benzyl-4H-pyridine-3-carboxamide |
| SMILES | CCN(CNC(=O)C1=CN(Cc2ccccc2)C=CC1)C(C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H31N3O3/c1-3-29(20(2)14-22-11-12-24-25(15-22)32-19-31-24)18-27-26(30)23-10-7-13-28(17-23)16-21-8-5-4-6-9-21/h4-9,11-13,15,17,20H,3,10,14,16,18-19H2,1-2H3,(H,27,30) |
| InChIKey | UKLBFBZENRSPDJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|