C20H32N4O3 — CID 168989274
N-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylamino]methyl]-3-piperazin-1-ylpropanamide (PubChem CID 168989274) has the molecular formula C20H32N4O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is N-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylamino]methyl]-3-piperazin-1-ylpropanamide.
| Compound Name | N-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylamino]methyl]-3-piperazin-1-ylpropanamide |
|---|---|
| PubChem CID | 168989274 |
| Molecular Formula | C20H32N4O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | N-[[1-(1,3-benzodioxol-5-yl)propan-2-yl-ethylamino]methyl]-3-piperazin-1-ylpropanamide |
| SMILES | CCN(CNC(=O)CCN1CCNCC1)C(C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H32N4O3/c1-3-24(14-22-20(25)6-9-23-10-7-21-8-11-23)16(2)12-17-4-5-18-19(13-17)27-15-26-18/h4-5,13,16,21H,3,6-12,14-15H2,1-2H3,(H,22,25) |
| InChIKey | WFVJFXKDMOMURR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|