C18H25N3O5 — CID 168989916
N-[[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]amino]methyl]-3-morpholin-4-ylpropanamide (PubChem CID 168989916) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is N-[[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]amino]methyl]-3-morpholin-4-ylpropanamide.
| Compound Name | N-[[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]amino]methyl]-3-morpholin-4-ylpropanamide |
|---|---|
| PubChem CID | 168989916 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | N-[[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]amino]methyl]-3-morpholin-4-ylpropanamide |
| SMILES | CC(NCNC(=O)CCN1CCOCC1)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H25N3O5/c1-13(18(23)14-2-3-15-16(10-14)26-12-25-15)19-11-20-17(22)4-5-21-6-8-24-9-7-21/h2-3,10,13,19H,4-9,11-12H2,1H3,(H,20,22) |
| InChIKey | BZSLORWYAMBRQH-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|