C18H25N3O4 — CID 168990134
N-[[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]amino]methyl]-2-piperidin-1-ylacetamide (PubChem CID 168990134) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is N-[[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]amino]methyl]-2-piperidin-1-ylacetamide.
| Compound Name | N-[[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]amino]methyl]-2-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 168990134 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N-[[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]amino]methyl]-2-piperidin-1-ylacetamide |
| SMILES | CC(NCNC(=O)CN1CCCCC1)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H25N3O4/c1-13(18(23)14-5-6-15-16(9-14)25-12-24-15)19-11-20-17(22)10-21-7-3-2-4-8-21/h5-6,9,13,19H,2-4,7-8,10-12H2,1H3,(H,20,22) |
| InChIKey | NNAHHSZNWAPZKK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|