C15H20N4O5 — CID 168990016
2-amino-N-[[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]amino]methyl]butanediamide (PubChem CID 168990016) has the molecular formula C15H20N4O5 and a molecular weight of 336.35 g/mol. Its IUPAC name is 2-amino-N-[[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]amino]methyl]butanediamide.
| Compound Name | 2-amino-N-[[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]amino]methyl]butanediamide |
|---|---|
| PubChem CID | 168990016 |
| Molecular Formula | C15H20N4O5 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 2-amino-N-[[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]amino]methyl]butanediamide |
| SMILES | CC(NCNC(=O)C(N)CC(N)=O)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H20N4O5/c1-8(18-6-19-15(22)10(16)5-13(17)20)14(21)9-2-3-11-12(4-9)24-7-23-11/h2-4,8,10,18H,5-7,16H2,1H3,(H2,17,20)(H,19,22) |
| InChIKey | BGNYVJCFAZMCIE-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|