C19H29N3O4 — CID 177118480
2-amino-N-[1-[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylamino]ethyl]-4-methylpentanamide (PubChem CID 177118480) has the molecular formula C19H29N3O4 and a molecular weight of 363.46 g/mol. Its IUPAC name is 2-amino-N-[1-[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylamino]ethyl]-4-methylpentanamide.
| Compound Name | 2-amino-N-[1-[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylamino]ethyl]-4-methylpentanamide |
|---|---|
| PubChem CID | 177118480 |
| Molecular Formula | C19H29N3O4 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 2-amino-N-[1-[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylamino]ethyl]-4-methylpentanamide |
| SMILES | CC(C)CC(N)C(=O)NC(C)N(C)C(C)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H29N3O4/c1-11(2)8-15(20)19(24)21-13(4)22(5)12(3)18(23)14-6-7-16-17(9-14)26-10-25-16/h6-7,9,11-13,15H,8,10,20H2,1-5H3,(H,21,24) |
| InChIKey | BVPCQZKZUQUBOZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|