C19H26N2O7S — CID 168989974
N-[1-[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylamino]ethyl]-3-(1,1-dioxothietan-3-yl)oxypropanamide (PubChem CID 168989974) has the molecular formula C19H26N2O7S and a molecular weight of 426.49 g/mol. Its IUPAC name is N-[1-[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylamino]ethyl]-3-(1,1-dioxothietan-3-yl)oxypropanamide.
| Compound Name | N-[1-[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylamino]ethyl]-3-(1,1-dioxothietan-3-yl)oxypropanamide |
|---|---|
| PubChem CID | 168989974 |
| Molecular Formula | C19H26N2O7S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | N-[1-[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylamino]ethyl]-3-(1,1-dioxothietan-3-yl)oxypropanamide |
| SMILES | CC(NC(=O)CCOC1CS(=O)(=O)C1)N(C)C(C)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H26N2O7S/c1-12(19(23)14-4-5-16-17(8-14)28-11-27-16)21(3)13(2)20-18(22)6-7-26-15-9-29(24,25)10-15/h4-5,8,12-13,15H,6-7,9-11H2,1-3H3,(H,20,22) |
| InChIKey | GCYYMAWACCTUKL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|