C22H29N3O4 — CID 168989868
N-[1-[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylamino]ethyl]-1-propan-2-yl-4H-pyridine-3-carboxamide (PubChem CID 168989868) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is N-[1-[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylamino]ethyl]-1-propan-2-yl-4H-pyridine-3-carboxamide.
| Compound Name | N-[1-[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylamino]ethyl]-1-propan-2-yl-4H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 168989868 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | N-[1-[[1-(1,3-benzodioxol-5-yl)-1-oxopropan-2-yl]-methylamino]ethyl]-1-propan-2-yl-4H-pyridine-3-carboxamide |
| SMILES | CC(C)N1C=CCC(C(=O)NC(C)N(C)C(C)C(=O)c2ccc3c(c2)OCO3)=C1 |
| InChI | InChI=1S/C22H29N3O4/c1-14(2)25-10-6-7-18(12-25)22(27)23-16(4)24(5)15(3)21(26)17-8-9-19-20(11-17)29-13-28-19/h6,8-12,14-16H,7,13H2,1-5H3,(H,23,27) |
| InChIKey | NSTITGUCSJBZPG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|