C20H26N2O4 — CID 170024911
1-(1,3-benzodioxol-5-yl)-2-[[hydroxy-(1-propyl-4H-pyridin-3-yl)methyl]-methylamino]propan-1-one (PubChem CID 170024911) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-[[hydroxy-(1-propyl-4H-pyridin-3-yl)methyl]-methylamino]propan-1-one.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-[[hydroxy-(1-propyl-4H-pyridin-3-yl)methyl]-methylamino]propan-1-one |
|---|---|
| PubChem CID | 170024911 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-[[hydroxy-(1-propyl-4H-pyridin-3-yl)methyl]-methylamino]propan-1-one |
| SMILES | CCCN1C=CCC(C(O)N(C)C(C)C(=O)c2ccc3c(c2)OCO3)=C1 |
| InChI | InChI=1S/C20H26N2O4/c1-4-9-22-10-5-6-16(12-22)20(24)21(3)14(2)19(23)15-7-8-17-18(11-15)26-13-25-17/h5,7-8,10-12,14,20,24H,4,6,9,13H2,1-3H3 |
| InChIKey | JBKTVCARQICZRZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|