C12H13NO5 — CID 82348774
methyl 3-amino-4-(1,3-benzodioxol-5-yl)-4-oxobutanoate (PubChem CID 82348774) has the molecular formula C12H13NO5 and a molecular weight of 251.24 g/mol. Its IUPAC name is methyl 3-amino-4-(1,3-benzodioxol-5-yl)-4-oxobutanoate.
| Compound Name | methyl 3-amino-4-(1,3-benzodioxol-5-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 82348774 |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | methyl 3-amino-4-(1,3-benzodioxol-5-yl)-4-oxobutanoate |
| SMILES | COC(=O)CC(N)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H13NO5/c1-16-11(14)5-8(13)12(15)7-2-3-9-10(4-7)18-6-17-9/h2-4,8H,5-6,13H2,1H3 |
| InChIKey | MHZWENKUKNQJHS-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |