methyl 3-[1,3-benzodioxole-5-carbonyl(methyl)amino]propanoate

C13H15NO5 — CID 54980166

IUPACmethyl 3-[1,3-benzodioxole-5-carbonyl(methyl)amino]propanoate
SMILESCOC(=O)CCN(C)C(=O)c1ccc2c(c1)OCO2
InChIInChI=1S/C13H15NO5/c1-14(6-5-12(15)17-2)13(16)9-3-4-10-11(7-9)19-8-18-10/h3-4,7H,5-6,8H2,1-2H3
InChIKeyHAYLJISYNINKJY-UHFFFAOYSA-N
MW265.26 g/mol
LogP1.05
Rot. Bonds4

About methyl 3-[1,3-benzodioxole-5-carbonyl(methyl)amino]propanoate

methyl 3-[1,3-benzodioxole-5-carbonyl(methyl)amino]propanoate (PubChem CID 54980166) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is methyl 3-[1,3-benzodioxole-5-carbonyl(methyl)amino]propanoate.

Molecular Properties

Compound Namemethyl 3-[1,3-benzodioxole-5-carbonyl(methyl)amino]propanoate
PubChem CID54980166
Molecular FormulaC13H15NO5
Molecular Weight265.26 g/mol
Exact Mass265.10
IUPAC Namemethyl 3-[1,3-benzodioxole-5-carbonyl(methyl)amino]propanoate
SMILESCOC(=O)CCN(C)C(=O)c1ccc2c(c1)OCO2
InChIInChI=1S/C13H15NO5/c1-14(6-5-12(15)17-2)13(16)9-3-4-10-11(7-9)19-8-18-10/h3-4,7H,5-6,8H2,1-2H3
InChIKeyHAYLJISYNINKJY-UHFFFAOYSA-N
XLogP1.05
TPSA65.07 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.26
LogP ≤ 51.05
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 3-[1,3-benzodioxole-5-carbonyl(methyl)amino]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[1,3-benzodioxole-5-carbonyl(methyl)amino]propanoate?
The IUPAC name of methyl 3-[1,3-benzodioxole-5-carbonyl(methyl)amino]propanoate (CID 54980166) is methyl 3-[1,3-benzodioxole-5-carbonyl(methyl)amino]propanoate.
What is the SMILES notation for methyl 3-[1,3-benzodioxole-5-carbonyl(methyl)amino]propanoate?
The canonical SMILES for methyl 3-[1,3-benzodioxole-5-carbonyl(methyl)amino]propanoate is COC(=O)CCN(C)C(=O)c1ccc2c(c1)OCO2.
What is the InChIKey of methyl 3-[1,3-benzodioxole-5-carbonyl(methyl)amino]propanoate?
The InChIKey is HAYLJISYNINKJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO5/c1-14(6-5-12(15)17-2)13(16)9-3-4-10-11(7-9)19-8-18-10/h3-4,7H,5-6,8H2,1-2H3.
What are the key properties of methyl 3-[1,3-benzodioxole-5-carbonyl(methyl)amino]propanoate?
methyl 3-[1,3-benzodioxole-5-carbonyl(methyl)amino]propanoate has a molecular weight of 265.26 g/mol, XLogP of 1.05, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[1,3-benzodioxole-5-carbonyl(methyl)amino]propanoate is sourced from PubChem (CID 54980166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).