C11H12O4 — CID 10081775
methyl 3-(1,3-benzodioxol-5-yl)propanoate (PubChem CID 10081775) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is methyl 3-(1,3-benzodioxol-5-yl)propanoate.
| Compound Name | methyl 3-(1,3-benzodioxol-5-yl)propanoate |
|---|---|
| PubChem CID | 10081775 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | methyl 3-(1,3-benzodioxol-5-yl)propanoate |
| SMILES | COC(=O)CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H12O4/c1-13-11(12)5-3-8-2-4-9-10(6-8)15-7-14-9/h2,4,6H,3,5,7H2,1H3 |
| InChIKey | GJIGKHHYGKPZAK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |