C14H18O3 — CID 167436498
1-(1,3-benzodioxol-5-yl)heptan-3-one (PubChem CID 167436498) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)heptan-3-one.
| Compound Name | 1-(1,3-benzodioxol-5-yl)heptan-3-one |
|---|---|
| PubChem CID | 167436498 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)heptan-3-one |
| SMILES | CCCCC(=O)CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H18O3/c1-2-3-4-12(15)7-5-11-6-8-13-14(9-11)17-10-16-13/h6,8-9H,2-5,7,10H2,1H3 |
| InChIKey | VVZDFYLZTVSDPV-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |