C15H22N2O3 — CID 47160647
1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-pentylurea (PubChem CID 47160647) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-pentylurea.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-pentylurea |
|---|---|
| PubChem CID | 47160647 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-pentylurea |
| SMILES | CCCCCNC(=O)NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H22N2O3/c1-2-3-4-8-16-15(18)17-9-7-12-5-6-13-14(10-12)20-11-19-13/h5-6,10H,2-4,7-9,11H2,1H3,(H2,16,17,18) |
| InChIKey | ZKOXWEAKPHTLHV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|