C14H19NO3S — CID 87011212
N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-propylsulfanylacetamide (PubChem CID 87011212) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-propylsulfanylacetamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-propylsulfanylacetamide |
|---|---|
| PubChem CID | 87011212 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-propylsulfanylacetamide |
| SMILES | CCCSCC(=O)NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H19NO3S/c1-2-7-19-9-14(16)15-6-5-11-3-4-12-13(8-11)18-10-17-12/h3-4,8H,2,5-7,9-10H2,1H3,(H,15,16) |
| InChIKey | BZKFJWRGVGWEQQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|