C16H23NO3S — CID 86836449
N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-(3-methylbutylsulfanyl)acetamide (PubChem CID 86836449) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-(3-methylbutylsulfanyl)acetamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-(3-methylbutylsulfanyl)acetamide |
|---|---|
| PubChem CID | 86836449 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-(3-methylbutylsulfanyl)acetamide |
| SMILES | CC(C)CCSCC(=O)NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H23NO3S/c1-12(2)6-8-21-10-16(18)17-7-5-13-3-4-14-15(9-13)20-11-19-14/h3-4,9,12H,5-8,10-11H2,1-2H3,(H,17,18) |
| InChIKey | HJTCXKIHTICFBR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|