C13H16N2O4 — CID 173077983
N'-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methylpropanediamide (PubChem CID 173077983) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is N'-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methylpropanediamide.
| Compound Name | N'-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methylpropanediamide |
|---|---|
| PubChem CID | 173077983 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | N'-[2-(1,3-benzodioxol-5-yl)ethyl]-2-methylpropanediamide |
| SMILES | CC(C(N)=O)C(=O)NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H16N2O4/c1-8(12(14)16)13(17)15-5-4-9-2-3-10-11(6-9)19-7-18-10/h2-3,6,8H,4-5,7H2,1H3,(H2,14,16)(H,15,17) |
| InChIKey | IOEZILXVJPTJGV-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|