C13H17N3O4 — CID 18159601
N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-(carbamoylamino)propanamide (PubChem CID 18159601) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-(carbamoylamino)propanamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-(carbamoylamino)propanamide |
|---|---|
| PubChem CID | 18159601 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-(carbamoylamino)propanamide |
| SMILES | CC(NC(N)=O)C(=O)NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H17N3O4/c1-8(16-13(14)18)12(17)15-5-4-9-2-3-10-11(6-9)20-7-19-10/h2-3,6,8H,4-5,7H2,1H3,(H,15,17)(H3,14,16,18) |
| InChIKey | SQKZHCYCWREIKD-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |