C19H20N2O4 — CID 18159582
N-[1-[2-(1,3-benzodioxol-5-yl)ethylamino]-1-oxopropan-2-yl]benzamide (PubChem CID 18159582) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-[1-[2-(1,3-benzodioxol-5-yl)ethylamino]-1-oxopropan-2-yl]benzamide.
| Compound Name | N-[1-[2-(1,3-benzodioxol-5-yl)ethylamino]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 18159582 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-[1-[2-(1,3-benzodioxol-5-yl)ethylamino]-1-oxopropan-2-yl]benzamide |
| SMILES | CC(NC(=O)c1ccccc1)C(=O)NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H20N2O4/c1-13(21-19(23)15-5-3-2-4-6-15)18(22)20-10-9-14-7-8-16-17(11-14)25-12-24-16/h2-8,11,13H,9-10,12H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | BFGJCONDWRVPBC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |