C16H24IN3O4 — CID 111380470
methyl 3-[[N-[2-(1,3-benzodioxol-5-yl)ethyl]-N'-methylcarbamimidoyl]amino]-2-methylpropanoate;hydroiodide (PubChem CID 111380470) has the molecular formula C16H24IN3O4 and a molecular weight of 449.29 g/mol. Its IUPAC name is methyl 3-[[N-[2-(1,3-benzodioxol-5-yl)ethyl]-N'-methylcarbamimidoyl]amino]-2-methylpropanoate;hydroiodide.
| Compound Name | methyl 3-[[N-[2-(1,3-benzodioxol-5-yl)ethyl]-N'-methylcarbamimidoyl]amino]-2-methylpropanoate;hydroiodide |
|---|---|
| PubChem CID | 111380470 |
| Molecular Formula | C16H24IN3O4 |
| Molecular Weight | 449.29 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | methyl 3-[[N-[2-(1,3-benzodioxol-5-yl)ethyl]-N'-methylcarbamimidoyl]amino]-2-methylpropanoate;hydroiodide |
| SMILES | C/N=C(/NCCc1ccc2c(c1)OCO2)NCC(C)C(=O)OC.I |
| InChI | InChI=1S/C16H23N3O4.HI/c1-11(15(20)21-3)9-19-16(17-2)18-7-6-12-4-5-13-14(8-12)23-10-22-13;/h4-5,8,11H,6-7,9-10H2,1-3H3,(H2,17,18,19);1H |
| InChIKey | FKVHFFVTGCLPAB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|