C19H31N3O3 — CID 111718012
1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(3-ethoxy-4-methylpentyl)-2-methylguanidine (PubChem CID 111718012) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(3-ethoxy-4-methylpentyl)-2-methylguanidine.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(3-ethoxy-4-methylpentyl)-2-methylguanidine |
|---|---|
| PubChem CID | 111718012 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)ethyl]-3-(3-ethoxy-4-methylpentyl)-2-methylguanidine |
| SMILES | CCOC(CCN/C(=N\C)NCCc1ccc2c(c1)OCO2)C(C)C |
| InChI | InChI=1S/C19H31N3O3/c1-5-23-16(14(2)3)9-11-22-19(20-4)21-10-8-15-6-7-17-18(12-15)25-13-24-17/h6-7,12,14,16H,5,8-11,13H2,1-4H3,(H2,20,21,22) |
| InChIKey | NHPVMWDESQIRFY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|