C11H13NO3S — CID 115167361
N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-sulfanylacetamide (PubChem CID 115167361) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-sulfanylacetamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-sulfanylacetamide |
|---|---|
| PubChem CID | 115167361 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-sulfanylacetamide |
| SMILES | O=C(CS)NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H13NO3S/c13-11(6-16)12-4-3-8-1-2-9-10(5-8)15-7-14-9/h1-2,5,16H,3-4,6-7H2,(H,12,13) |
| InChIKey | JBYCCWKAKFWFCG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|