C17H16FNO3 — CID 110767389
2-(1,3-benzodioxol-5-yl)-N-[2-(4-fluorophenyl)ethyl]acetamide (PubChem CID 110767389) has the molecular formula C17H16FNO3 and a molecular weight of 301.32 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[2-(4-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[2-(4-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 110767389 |
| Molecular Formula | C17H16FNO3 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[2-(4-fluorophenyl)ethyl]acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H16FNO3/c18-14-4-1-12(2-5-14)7-8-19-17(20)10-13-3-6-15-16(9-13)22-11-21-15/h1-6,9H,7-8,10-11H2,(H,19,20) |
| InChIKey | YWQRNHOCODJHGE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |