C15H21NO3S — CID 35371796
N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-tert-butylsulfanylacetamide (PubChem CID 35371796) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-tert-butylsulfanylacetamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-tert-butylsulfanylacetamide |
|---|---|
| PubChem CID | 35371796 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2-tert-butylsulfanylacetamide |
| SMILES | CC(C)(C)SCC(=O)NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H21NO3S/c1-15(2,3)20-9-14(17)16-7-6-11-4-5-12-13(8-11)19-10-18-12/h4-5,8H,6-7,9-10H2,1-3H3,(H,16,17) |
| InChIKey | IEUUFAOCHPRPKQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |